cas: 160256-75-7 — see every product listed under this CAS number, including other names
Z-EDA-EDA-Z (CAS 160256-75-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Iris Biotech, Fluorochem.
| brand | Iris Biotech |
|---|---|
| catalog number | ZNN1048.0001 |
| cas | 160256-75-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Iris Biotech | 1g | 912.56 Pln | |
| Iris Biotech | 5g | 2868.80 Pln | |
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 5g | 1507.82 Pln |
| purity | No data |
|---|---|
| delivery time | 2 weeks |
Benzyl N-[2-[2-(phenylmethoxycarbonylamino)ethylamino]ethyl]carbamate (CAS 160256-75-7) is a chemical compound with the molecular formula C20H25N3O4 and a molecular weight of 371.4 g/mol. IUPAC name: benzyl N-[2-[2-(phenylmethoxycarbonylamino)ethylamino]ethyl]carbamate. InChIKey: DWPBEWIGNADCAX-UHFFFAOYSA-N.
| Molecular formula | C20H25N3O4 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | benzyl N-[2-[2-(phenylmethoxycarbonylamino)ethylamino]ethyl]carbamate |
| InChIKey | DWPBEWIGNADCAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCNCCNC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)