N,N'-(Ethane-1,2-diyl)bis(N-methylbenzamide), 95%
cas: 24768-61-4 — see every product listed under this CAS number, including other names
N,N'-(Ethane-1,2-diyl)bis(N-methylbenzamide), 95% (CAS 24768-61-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2477269-1g |
| cas | 24768-61-4 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 820.94 Pln | |
| Ambeed | 25g | 2706.62 Pln | |
| Ambeed | 100g | 8536.12 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 818.00 Pln | |
| Chemat | 25g | 2709.20 Pln | |
| Chemat | 100g | 9083.60 Pln | |
| BLDpharm | 1g | 303.25 Pln | |
| BLDpharm | 5g | 880.83 Pln | |
| BLDpharm | 25g | 2913.44 Pln | |
| BLDpharm | 100g | 9200.12 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
N-[2-[benzoyl(methyl)amino]ethyl]-N-methylbenzamide (CAS 24768-61-4) is a chemical compound with the molecular formula C18H20N2O2 and a molecular weight of 296.4 g/mol. IUPAC name: N-[2-[benzoyl(methyl)amino]ethyl]-N-methylbenzamide. InChIKey: GKJNYSVSIQKNEV-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | N-[2-[benzoyl(methyl)amino]ethyl]-N-methylbenzamide |
| InChIKey | GKJNYSVSIQKNEV-UHFFFAOYSA-N |
| SMILES | CN(CCN(C)C(=O)C1=CC=CC=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)