CAS 461393-36-2 is the registry number for cis-4,4'-Diphenyl-2,2'-bioxazolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-4-phenyl-2-[(4R)-4-phenyl-1,3-oxazolidin-2-yl]-1,3-oxazolidine (CAS 461393-36-2) is a chemical compound with the molecular formula C18H20N2O2 and a molecular weight of 296.4 g/mol. IUPAC name: (4R)-4-phenyl-2-[(4R)-4-phenyl-1,3-oxazolidin-2-yl]-1,3-oxazolidine. InChIKey: SBFHUUGRZAZATD-VYMRPNJYSA-N.
| Molecular formula | C18H20N2O2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | (4R)-4-phenyl-2-[(4R)-4-phenyl-1,3-oxazolidin-2-yl]-1,3-oxazolidine |
| InChIKey | SBFHUUGRZAZATD-VYMRPNJYSA-N |
| SMILES | C1[C@H](NC(O1)C2N[C@@H](CO2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)