cas: 65181-78-4 — see every product listed under this CAS number, including other names
N,N'-Bis(3-methylphenyl)-N,N'-bis(phenyl)benzidine, 98% (CAS 65181-78-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 457180010 |
| cas | 65181-78-4 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 209.36 Pln | |
| Thermo Scientific (Acros) | 5g | 605.81 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
3-methyl-N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]-N-phenylaniline (CAS 65181-78-4) is a chemical compound with the molecular formula C38H32N2 and a molecular weight of 516.7 g/mol. IUPAC name: 3-methyl-N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]-N-phenylaniline. InChIKey: OGGKVJMNFFSDEV-UHFFFAOYSA-N.
| Molecular formula | C38H32N2 |
|---|---|
| Molecular weight | 516.7 g/mol |
| IUPAC name | 3-methyl-N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]-N-phenylaniline |
| InChIKey | OGGKVJMNFFSDEV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)N(C5=CC=CC=C5)C6=CC=CC(=C6)C |
Computed by PubChem (NCBI)