cas: 65181-78-4 — see every product listed under this CAS number, including other names
N,N'-Diphenyl-N,N'-di(m-tolyl)benzidine (purified by sublimation), >99.0%(HPLC)(N) (CAS 65181-78-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D3236-1G |
| cas | 65181-78-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 503.38 Pln | |
| TCI | 5g | 1280.31 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(HPLC)(N) |
3-methyl-N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]-N-phenylaniline (CAS 65181-78-4) is a chemical compound with the molecular formula C38H32N2 and a molecular weight of 516.7 g/mol. IUPAC name: 3-methyl-N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]-N-phenylaniline. InChIKey: OGGKVJMNFFSDEV-UHFFFAOYSA-N.
| Molecular formula | C38H32N2 |
|---|---|
| Molecular weight | 516.7 g/mol |
| IUPAC name | 3-methyl-N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]-N-phenylaniline |
| InChIKey | OGGKVJMNFFSDEV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)N(C5=CC=CC=C5)C6=CC=CC(=C6)C |
Computed by PubChem (NCBI)