cas: 28726-30-9 — see every product listed under this CAS number, including other names
N,N'-Dixylyl-p-phenylenediamine, 95%, 95% (CAS 28726-30-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113W0P-100mg |
| cas | 28726-30-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1029.20 Pln | |
| Chemat | 250mg | 1854.80 Pln | |
| Chemat | 1g | 6333.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-N,4-N-bis(2,3-dimethylphenyl)benzene-1,4-diamine (CAS 28726-30-9) is a chemical compound with the molecular formula C22H24N2 and a molecular weight of 316.4 g/mol. IUPAC name: 1-N,4-N-bis(2,3-dimethylphenyl)benzene-1,4-diamine. InChIKey: WAQPDYDRPQTELB-UHFFFAOYSA-N.
| Molecular formula | C22H24N2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 1-N,4-N-bis(2,3-dimethylphenyl)benzene-1,4-diamine |
| InChIKey | WAQPDYDRPQTELB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC2=CC=C(C=C2)NC3=CC=CC(=C3C)C)C |
Computed by PubChem (NCBI)