N,N,N-Trimethyloctan-1-aminium chloride, 99% (T)
cas: 10108-86-8 — see every product listed under this CAS number, including other names
N,N,N-Trimethyloctan-1-aminium chloride, 99% (T) (CAS 10108-86-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A897390-25g |
| cas | 10108-86-8 |
| size | 25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 337.00 Pln | |
| Ambeed | 500g | 993.38 Pln | |
| Ambeed | 1kg | 1644.19 Pln | |
| BLDpharm | 25g | 186.63 Pln | |
| BLDpharm | 100g | 353.23 Pln | |
| BLDpharm | 500g | 1069.65 Pln | |
| BLDpharm | 1kg | 1769.40 Pln |
properties
| purity | 99% (T) |
|---|---|
| delivery time | 1-2 weeks |
Trimethyl(octyl)azanium chloride (CAS 10108-86-8) is a chemical compound with the molecular formula C11H26ClN and a molecular weight of 207.78 g/mol. IUPAC name: trimethyl(octyl)azanium chloride. InChIKey: AQZSPJRLCJSOED-UHFFFAOYSA-M.
| Molecular formula | C11H26ClN |
|---|---|
| Molecular weight | 207.78 g/mol |
| IUPAC name | trimethyl(octyl)azanium chloride |
| InChIKey | AQZSPJRLCJSOED-UHFFFAOYSA-M |
| SMILES | CCCCCCCC[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Octyltrimethylammonium chloride, Caprylyltrimethylammonium chloride, 1-Octanaminium, N,N,N-trimethyl-, chloride, n-Octyltrimethylammonium Chloride, Trimethyloctylammonium chloride, N,N,N-Trimethyloctan-1-aminium chloride, trimethyl(octyl)azanium;chloride, trimethyl(octyl)azanium chloride, Trimethyl-n-o, Ammonium, trimethyloctyl-, chloride