CAS 10108-86-8 appears in our catalog under these names: N-Octyltrimethylammonium chloride, 97%, Trimethyloctylammonium Chloride, >95% (HPLC), N,N,N–Trimethyloctan–1–aminium chloride, n-Octyltrimethylammonium Chloride, >98.0%(T), Octyltrimethylammonium chloride, 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Thermo Scientific (Acros). Available pack sizes: 25g, 100g, 5g, 1g, 250mg, 500g, 1000g, 100 g.
Trimethyl(octyl)azanium chloride (CAS 10108-86-8) is a chemical compound with the molecular formula C11H26ClN and a molecular weight of 207.78 g/mol. IUPAC name: trimethyl(octyl)azanium chloride. InChIKey: AQZSPJRLCJSOED-UHFFFAOYSA-M.
| Molecular formula | C11H26ClN |
|---|---|
| Molecular weight | 207.78 g/mol |
| IUPAC name | trimethyl(octyl)azanium chloride |
| InChIKey | AQZSPJRLCJSOED-UHFFFAOYSA-M |
| SMILES | CCCCCCCC[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)