cas: 152120-54-2 — see every product listed under this CAS number, including other names
N,N-Bis-Boc-1-Guanylpyrazole, 98%, 98% (CAS 152120-54-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146B2-1g |
| cas | 152120-54-2 |
| size | 1g |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 50g | 222.80 Pln | |
| Chemat | 100g | 366.80 Pln | |
| Chemat | 250g | 750.80 Pln | |
| Chemat | 500g | 1372.80 Pln | |
| Chemat | 1kg | 2454.80 Pln | |
| Chemat | 5kg | 8587.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-pyrazol-1-ylmethylidene]carbamate (CAS 152120-54-2) is a chemical compound with the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. IUPAC name: tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-pyrazol-1-ylmethylidene]carbamate. InChIKey: QFNFDHNZVTWZED-UHFFFAOYSA-N.
| Molecular formula | C14H22N4O4 |
|---|---|
| Molecular weight | 310.35 g/mol |
| IUPAC name | tert-butyl N-[[(2-methylpropan-2-yl)oxycarbonylamino]-pyrazol-1-ylmethylidene]carbamate |
| InChIKey | QFNFDHNZVTWZED-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(=NC(=O)OC(C)(C)C)N1C=CC=N1 |
Computed by PubChem (NCBI)