CAS 1234615-84-9 appears in our catalog under these names: 5-(1,2-Di-boc-hydrazino)pyrimidine, 95%, Di-tert-butyl 1-(pyrimidin-5-yl)hydrazine-1,2-dicarboxylate, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-pyrimidin-5-ylcarbamate (CAS 1234615-84-9) is a chemical compound with the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. IUPAC name: tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-pyrimidin-5-ylcarbamate. InChIKey: DXJVUWWLMCSKTA-UHFFFAOYSA-N.
| Molecular formula | C14H22N4O4 |
|---|---|
| Molecular weight | 310.35 g/mol |
| IUPAC name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-pyrimidin-5-ylcarbamate |
| InChIKey | DXJVUWWLMCSKTA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NN(C1=CN=CN=C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)