N,N-Diethyl-4-iodobenzamide, 98%
cas: 77350-52-8 — see every product listed under this CAS number, including other names
N,N-Diethyl-4-iodobenzamide, 98% (CAS 77350-52-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A104768-250mg |
| cas | 77350-52-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 403.75 Pln | |
| Ambeed | 5g | 1071.25 Pln | |
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 616.40 Pln | |
| Chemat | 5g | 1998.80 Pln | |
| BLDpharm | 100mg | 219.95 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 430.98 Pln | |
| BLDpharm | 5g | 1147.40 Pln | |
| Fluorochem | 100mg | 367.60 Pln | |
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 1g | 1132.95 Pln | |
| Fluorochem | 5g | 3694.55 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
N,N-diethyl-4-iodobenzamide (CAS 77350-52-8) is a chemical compound with the molecular formula C11H14INO and a molecular weight of 303.14 g/mol. IUPAC name: N,N-diethyl-4-iodobenzamide. InChIKey: GHOMPHXKTJFWCV-UHFFFAOYSA-N.
| Molecular formula | C11H14INO |
|---|---|
| Molecular weight | 303.14 g/mol |
| IUPAC name | N,N-diethyl-4-iodobenzamide |
| InChIKey | GHOMPHXKTJFWCV-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(C=C1)I |
Computed by PubChem (NCBI)