CAS 1344287-16-6 is the registry number for 2-Iodo-N-mesitylacetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-iodo-N-(2,4,6-trimethylphenyl)acetamide (CAS 1344287-16-6) is a chemical compound with the molecular formula C11H14INO and a molecular weight of 303.14 g/mol. IUPAC name: 2-iodo-N-(2,4,6-trimethylphenyl)acetamide. InChIKey: HZHDEEVJHQWEGS-UHFFFAOYSA-N.
| Molecular formula | C11H14INO |
|---|---|
| Molecular weight | 303.14 g/mol |
| IUPAC name | 2-iodo-N-(2,4,6-trimethylphenyl)acetamide |
| InChIKey | HZHDEEVJHQWEGS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC(=O)CI)C |
Computed by PubChem (NCBI)