cas: 911227-46-8 — see every product listed under this CAS number, including other names
N,N-Diethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinamide, 95% (CAS 911227-46-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692511-100MG |
| cas | 911227-46-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 825.77 Pln | |
| Fluorochem | 1g | 2106.57 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
N,N-diethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide (CAS 911227-46-8) is a chemical compound with the molecular formula C16H25BN2O3 and a molecular weight of 304.2 g/mol. IUPAC name: N,N-diethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide. InChIKey: KCJOSYVHWLABNF-UHFFFAOYSA-N.
| Molecular formula | C16H25BN2O3 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | N,N-diethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxamide |
| InChIKey | KCJOSYVHWLABNF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C(=O)N(CC)CC |
Computed by PubChem (NCBI)