cas: 1073371-85-3 — see every product listed under this CAS number, including other names
N,N-Dimethyl-1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanamine hydrochloride, 98% (CAS 1073371-85-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603848-100MG |
| cas | 1073371-85-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 565.44 Pln | |
| Fluorochem | 5g | 1841.04 Pln | |
| Fluorochem | 25g | 8099.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N,N-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine;hydrochloride (CAS 1073371-85-3) is a chemical compound with the molecular formula C15H25BClNO2 and a molecular weight of 297.6 g/mol. IUPAC name: N,N-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine;hydrochloride. InChIKey: WQRBUTFEVSUAFF-UHFFFAOYSA-N.
| Molecular formula | C15H25BClNO2 |
|---|---|
| Molecular weight | 297.6 g/mol |
| IUPAC name | N,N-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine;hydrochloride |
| InChIKey | WQRBUTFEVSUAFF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CN(C)C.Cl |
Computed by PubChem (NCBI)