Products 2761039-89-6
CAS 2761039-89-6 is the registry number for (R)-4-(1-Aminoethyl)-3-methylphenylboronic Acid Pinacol Ester Hydrochloride, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 5g.
1-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine;hydrochloride (CAS 2761039-89-6) is a chemical compound with the molecular formula C15H25BClNO2 and a molecular weight of 297.6 g/mol. IUPAC name: 1-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine;hydrochloride. InChIKey: VRFPGHCNQFFMRD-UHFFFAOYSA-N.
| Molecular formula | C15H25BClNO2 |
|---|---|
| Molecular weight | 297.6 g/mol |
| IUPAC name | 1-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine;hydrochloride |
| InChIKey | VRFPGHCNQFFMRD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(C)N)C.Cl |
Computed by PubChem (NCBI)