cas: 873078-93-4 — see every product listed under this CAS number, including other names
N,N-Dimethyl-2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)ethanamine, 98% (CAS 873078-93-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212949-100MG |
| cas | 873078-93-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 409.25 Pln | |
| Fluorochem | 500mg | 638.33 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 1950.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N,N-dimethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethanamine (CAS 873078-93-4) is a chemical compound with the molecular formula C16H26BNO3 and a molecular weight of 291.2 g/mol. IUPAC name: N,N-dimethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethanamine. InChIKey: JUVPIBHZWGVRFL-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO3 |
|---|---|
| Molecular weight | 291.2 g/mol |
| IUPAC name | N,N-dimethyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethanamine |
| InChIKey | JUVPIBHZWGVRFL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCN(C)C |
Computed by PubChem (NCBI)