CAS 1346707-94-5 is the registry number for 2-(Neopentyloxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(2,2-dimethylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1346707-94-5) is a chemical compound with the molecular formula C16H26BNO3 and a molecular weight of 291.2 g/mol. IUPAC name: 2-(2,2-dimethylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: DYGKFLLLHNGCLM-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO3 |
|---|---|
| Molecular weight | 291.2 g/mol |
| IUPAC name | 2-(2,2-dimethylpropoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | DYGKFLLLHNGCLM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)OCC(C)(C)C |
Computed by PubChem (NCBI)