cas: 486422-05-3 — see every product listed under this CAS number, including other names
N,N-Dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide 98% (CAS 486422-05-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A869799-10g |
| cas | 486422-05-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1621.94 Pln | |
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 882.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A869799 |
N,N-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (CAS 486422-05-3) is a chemical compound with the molecular formula C14H22BNO4S and a molecular weight of 311.2 g/mol. IUPAC name: N,N-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide. InChIKey: YFEWVSRTWWHXFP-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO4S |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | N,N-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| InChIKey | YFEWVSRTWWHXFP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)