Products 2121513-29-7
CAS 2121513-29-7 appears in our catalog under these names: 2,6-Dimethoxy-5-(methylthio)pyridine-3-boronic acid pinacol ester, 95%, 2,6-Dimethoxy-5-(methylthio)pyridine-3-boronic acid pinacol ester. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg.
2,6-dimethoxy-3-methylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2121513-29-7) is a chemical compound with the molecular formula C14H22BNO4S and a molecular weight of 311.2 g/mol. IUPAC name: 2,6-dimethoxy-3-methylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: WPBQDTTXSQNMRV-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO4S |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | 2,6-dimethoxy-3-methylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | WPBQDTTXSQNMRV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2OC)OC)SC |
Computed by PubChem (NCBI)