cas: 329-00-0 — see every product listed under this CAS number, including other names
N,N-Dimethyl-3-(trifluoromethyl)benzenamine, ≥98%, ≥98% (CAS 329-00-0) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 5g, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DFDK-200mg |
| cas | 329-00-0 |
| size | 200mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 270.80 Pln | |
| Chemat | 5g | 2123.60 Pln | |
| Chemat | 1g | 525.20 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
N,N-dimethyl-3-(trifluoromethyl)aniline (CAS 329-00-0) is a chemical compound with the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. IUPAC name: N,N-dimethyl-3-(trifluoromethyl)aniline. InChIKey: UYKRFRIIVXQIHO-UHFFFAOYSA-N.
| Molecular formula | C9H10F3N |
|---|---|
| Molecular weight | 189.18 g/mol |
| IUPAC name | N,N-dimethyl-3-(trifluoromethyl)aniline |
| InChIKey | UYKRFRIIVXQIHO-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC(=C1)C(F)(F)F |
Computed by PubChem (NCBI)