cas: 1007126-41-1 — see every product listed under this CAS number, including other names
N,N-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine 98% (CAS 1007126-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A463450-100mg |
| cas | 1007126-41-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1193.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A463450 |
N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine (CAS 1007126-41-1) is a chemical compound with the molecular formula C18H24BNO2 and a molecular weight of 297.2 g/mol. IUPAC name: N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine. InChIKey: JXQGIGJKFBLRGA-UHFFFAOYSA-N.
| Molecular formula | C18H24BNO2 |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-amine |
| InChIKey | JXQGIGJKFBLRGA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C3=CC=CC=C23)N(C)C |
Computed by PubChem (NCBI)