cas: 712-80-1 — see every product listed under this CAS number, including other names
N,N-Dimethyl-4-(thiazolidin-2-yl)aniline 95+% (CAS 712-80-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A651694-250mg |
| cas | 712-80-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2689.94 Pln | |
| Ambeed | 25g | 9237.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A651694 |
N,N-dimethyl-4-(1,3-thiazolidin-2-yl)aniline (CAS 712-80-1) is a chemical compound with the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. IUPAC name: N,N-dimethyl-4-(1,3-thiazolidin-2-yl)aniline. InChIKey: ISSWNDGJXPGDPC-UHFFFAOYSA-N.
| Molecular formula | C11H16N2S |
|---|---|
| Molecular weight | 208.33 g/mol |
| IUPAC name | N,N-dimethyl-4-(1,3-thiazolidin-2-yl)aniline |
| InChIKey | ISSWNDGJXPGDPC-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2NCCS2 |
Computed by PubChem (NCBI)