cas: 712-80-1 — see every product listed under this CAS number, including other names
N,N-Dimethyl-4-(thiazolidin-2-yl)aniline, 95+%, 95+% (CAS 712-80-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FB25-250mg |
| cas | 712-80-1 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 635.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
N,N-dimethyl-4-(1,3-thiazolidin-2-yl)aniline (CAS 712-80-1) is a chemical compound with the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. IUPAC name: N,N-dimethyl-4-(1,3-thiazolidin-2-yl)aniline. InChIKey: ISSWNDGJXPGDPC-UHFFFAOYSA-N.
| Molecular formula | C11H16N2S |
|---|---|
| Molecular weight | 208.33 g/mol |
| IUPAC name | N,N-dimethyl-4-(1,3-thiazolidin-2-yl)aniline |
| InChIKey | ISSWNDGJXPGDPC-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2NCCS2 |
Computed by PubChem (NCBI)