N,N-Dimethyl-4-(trifluoromethyl)aniline, 98%
cas: 329-17-9 — see every product listed under this CAS number, including other names
N,N-Dimethyl-4-(trifluoromethyl)aniline, 98% (CAS 329-17-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1251175-100mg |
| cas | 329-17-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 1443.94 Pln | |
| BLDpharm | 100mg | 386.56 Pln | |
| BLDpharm | 250mg | 580.93 Pln | |
| BLDpharm | 1g | 1552.81 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 443.60 Pln | |
| Chemat | 5g | 1773.20 Pln | |
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 351.98 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
N,N-dimethyl-4-(trifluoromethyl)aniline (CAS 329-17-9) is a chemical compound with the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. IUPAC name: N,N-dimethyl-4-(trifluoromethyl)aniline. InChIKey: MLFFPCMQWLVVLM-UHFFFAOYSA-N.
| Molecular formula | C9H10F3N |
|---|---|
| Molecular weight | 189.18 g/mol |
| IUPAC name | N,N-dimethyl-4-(trifluoromethyl)aniline |
| InChIKey | MLFFPCMQWLVVLM-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)