cas: 2681-30-3 — see every product listed under this CAS number, including other names
N,N-Dimethyl-4-ethenylbenzamide, 95%+, 95%+ (CAS 2681-30-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12NYKV-100mg |
| cas | 2681-30-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2128.40 Pln | |
| Chemat | 250mg | 3506.00 Pln | |
| Chemat | 1g | 5574.80 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
4-ethenyl-N,N-dimethylbenzamide (CAS 2681-30-3) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 4-ethenyl-N,N-dimethylbenzamide. InChIKey: NULTZDKVDSTIEU-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 4-ethenyl-N,N-dimethylbenzamide |
| InChIKey | NULTZDKVDSTIEU-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=C(C=C1)C=C |
Computed by PubChem (NCBI)