cas: 1032759-30-0 — see every product listed under this CAS number, including other names
N,N-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine 98% (CAS 1032759-30-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A730661-100mg |
| cas | 1032759-30-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 865.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A730661 |
N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (CAS 1032759-30-0) is a chemical compound with the molecular formula C12H20BN3O2 and a molecular weight of 249.12 g/mol. IUPAC name: N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine. InChIKey: RMPRVJCNMPFBCX-UHFFFAOYSA-N.
| Molecular formula | C12H20BN3O2 |
|---|---|
| Molecular weight | 249.12 g/mol |
| IUPAC name | N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| InChIKey | RMPRVJCNMPFBCX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N(C)C |
Computed by PubChem (NCBI)