CAS 1391055-80-3 is the registry number for N,4-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (CAS 1391055-80-3) is a chemical compound with the molecular formula C12H20BN3O2 and a molecular weight of 249.12 g/mol. IUPAC name: N,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine. InChIKey: CXYGPGZJJBKGFI-UHFFFAOYSA-N.
| Molecular formula | C12H20BN3O2 |
|---|---|
| Molecular weight | 249.12 g/mol |
| IUPAC name | N,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| InChIKey | CXYGPGZJJBKGFI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2C)NC |
Computed by PubChem (NCBI)