cas: 896-05-9 — see every product listed under this CAS number, including other names
N,N-dimethyl-4-(((4-nitrophenyl)imino)methyl)aniline, 97%, 97% (CAS 896-05-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K8T-250mg |
| cas | 896-05-9 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 347.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N,N-dimethyl-4-[(4-nitrophenyl)iminomethyl]aniline (CAS 896-05-9) is a chemical compound with the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. IUPAC name: N,N-dimethyl-4-[(4-nitrophenyl)iminomethyl]aniline. InChIKey: RLDPRVKBHPQKIK-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O2 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | N,N-dimethyl-4-[(4-nitrophenyl)iminomethyl]aniline |
| InChIKey | RLDPRVKBHPQKIK-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C=NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)