N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-methyl-L-alloisoleucine, 98%
cas: 1821797-58-3 — see every product listed under this CAS number, including other names
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-methyl-L-alloisoleucine, 98% (CAS 1821797-58-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD01334960-50mg |
| cas | 1821797-58-3 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 50mg | 553.16 Pln | |
| BLDpharm | 100mg | 891.93 Pln | |
| BLDpharm | 250mg | 1730.53 Pln | |
| BLDpharm | 1g | 4246.31 Pln | |
| BLDpharm | 5g | 12487.85 Pln | |
| BLDpharm | 10g | 19935.23 Pln | |
| Chemat | 50mg | 515.60 Pln | |
| Chemat | 100mg | 832.40 Pln | |
| Chemat | 250mg | 1614.80 Pln | |
| Chemat | 1g | 3962.00 Pln | |
| Chemat | 5g | 11656.40 Pln | |
| Chemat | 10g | 18611.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoic acid (CAS 1821797-58-3) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoic acid. InChIKey: IQIOLCJHRZWOLS-VLIAUNLRSA-N.
| Molecular formula | C22H25NO4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2S,3R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoic acid |
| InChIKey | IQIOLCJHRZWOLS-VLIAUNLRSA-N |
| SMILES | CC[C@@H](C)[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)