cas: 5391-29-7 — see every product listed under this CAS number, including other names
N-((2-Bromophenyl)carbamothioyl)benzamide, 97% (CAS 5391-29-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F496867-250MG |
| cas | 5391-29-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 981.96 Pln | |
| Fluorochem | 5g | 2528.29 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-[(2-bromophenyl)carbamothioyl]benzamide (CAS 5391-29-7) is a chemical compound with the molecular formula C14H11BrN2OS and a molecular weight of 335.22 g/mol. IUPAC name: N-[(2-bromophenyl)carbamothioyl]benzamide. InChIKey: DNXBFCJFFLDLAK-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2OS |
|---|---|
| Molecular weight | 335.22 g/mol |
| IUPAC name | N-[(2-bromophenyl)carbamothioyl]benzamide |
| InChIKey | DNXBFCJFFLDLAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=S)NC2=CC=CC=C2Br |
Computed by PubChem (NCBI)