CAS 2387600-65-7 is the registry number for 8-Amino-2-bromo-7-methyl-3-phenyl-5H-thiazolo[3,2-a]pyridin-5-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-amino-2-bromo-7-methyl-3-phenyl-[1,3]thiazolo[3,2-a]pyridin-5-one (CAS 2387600-65-7) is a chemical compound with the molecular formula C14H11BrN2OS and a molecular weight of 335.22 g/mol. IUPAC name: 8-amino-2-bromo-7-methyl-3-phenyl-[1,3]thiazolo[3,2-a]pyridin-5-one. InChIKey: KEVOMGNINQZCAP-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2OS |
|---|---|
| Molecular weight | 335.22 g/mol |
| IUPAC name | 8-amino-2-bromo-7-methyl-3-phenyl-[1,3]thiazolo[3,2-a]pyridin-5-one |
| InChIKey | KEVOMGNINQZCAP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=C(SC2=C1N)Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)