cas: 1073355-09-5 — see every product listed under this CAS number, including other names
N-((Tetrahydrofuran-2-yl)methyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide 97% (CAS 1073355-09-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A515127-250mg |
| cas | 1073355-09-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1171.38 Pln | |
| Ambeed | 25g | 5315.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A515127 |
N-(oxolan-2-ylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1073355-09-5) is a chemical compound with the molecular formula C18H26BNO4 and a molecular weight of 331.2 g/mol. IUPAC name: N-(oxolan-2-ylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: ARPZLVWOFIPRHY-UHFFFAOYSA-N.
| Molecular formula | C18H26BNO4 |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | N-(oxolan-2-ylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | ARPZLVWOFIPRHY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NCC3CCCO3 |
Computed by PubChem (NCBI)