cas: 1171503-08-4 — see every product listed under this CAS number, including other names
N-(1-(Aminomethyl)cyclohexyl)methanesulfonamide hydrochloride, 98% (CAS 1171503-08-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A862062-10g |
| cas | 1171503-08-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 28167.16 Pln | |
| AmBeed | 5g | 20127.31 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-[1-(aminomethyl)cyclohexyl]methanesulfonamide;hydrochloride (CAS 1171503-08-4) is a chemical compound with the molecular formula C8H19ClN2O2S and a molecular weight of 242.77 g/mol. IUPAC name: N-[1-(aminomethyl)cyclohexyl]methanesulfonamide;hydrochloride. InChIKey: PROJKJACUBBVBR-UHFFFAOYSA-N.
| Molecular formula | C8H19ClN2O2S |
|---|---|
| Molecular weight | 242.77 g/mol |
| IUPAC name | N-[1-(aminomethyl)cyclohexyl]methanesulfonamide;hydrochloride |
| InChIKey | PROJKJACUBBVBR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1(CCCCC1)CN.Cl |
Computed by PubChem (NCBI)