CAS 2504202-71-3 is the registry number for 1-((Diethylamino)methyl)cyclopropane-1-sulfonamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 500mg.
1-(diethylaminomethyl)cyclopropane-1-sulfonamide;hydrochloride (CAS 2504202-71-3) is a chemical compound with the molecular formula C8H19ClN2O2S and a molecular weight of 242.77 g/mol. IUPAC name: 1-(diethylaminomethyl)cyclopropane-1-sulfonamide;hydrochloride. InChIKey: JQYBINSUFHOEII-UHFFFAOYSA-N.
| Molecular formula | C8H19ClN2O2S |
|---|---|
| Molecular weight | 242.77 g/mol |
| IUPAC name | 1-(diethylaminomethyl)cyclopropane-1-sulfonamide;hydrochloride |
| InChIKey | JQYBINSUFHOEII-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC1(CC1)S(=O)(=O)N.Cl |
Computed by PubChem (NCBI)