cas: 31582-37-3 — see every product listed under this CAS number, including other names
N-(2,2,6,6-TETRAMETHYL-4-PIPERIDINYL)-2-PROPENAMIDE, 95%, 95% (CAS 31582-37-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AJ7-250mg |
| cas | 31582-37-3 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 3165.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enamide (CAS 31582-37-3) is a chemical compound with the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. IUPAC name: N-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enamide. InChIKey: REKHXRWEQQXQLZ-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O |
|---|---|
| Molecular weight | 210.32 g/mol |
| IUPAC name | N-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enamide |
| InChIKey | REKHXRWEQQXQLZ-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1)(C)C)NC(=O)C=C)C |
Computed by PubChem (NCBI)