cas: 31582-37-3 — see every product listed under this CAS number, including other names
N-(2,2,6,6-Tetramethylpiperidin-4-yl)acrylamide 97% (CAS 31582-37-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1145254-250mg |
| cas | 31582-37-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 698.56 Pln | |
| Ambeed | 1g | 1327.12 Pln | |
| Ambeed | 5g | 6350.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1145254 |
N-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enamide (CAS 31582-37-3) is a chemical compound with the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. IUPAC name: N-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enamide. InChIKey: REKHXRWEQQXQLZ-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O |
|---|---|
| Molecular weight | 210.32 g/mol |
| IUPAC name | N-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enamide |
| InChIKey | REKHXRWEQQXQLZ-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1)(C)C)NC(=O)C=C)C |
Computed by PubChem (NCBI)