cas: 1063733-41-4 — see every product listed under this CAS number, including other names
N-(2,4-Dimethoxybenzyl)-1,2,4-thiadiazol-5-amine 97% (CAS 1063733-41-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A294200-100mg |
| cas | 1063733-41-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1304.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A294200 |
N-[(2,4-dimethoxyphenyl)methyl]-1,2,4-thiadiazol-5-amine (CAS 1063733-41-4) is a chemical compound with the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. IUPAC name: N-[(2,4-dimethoxyphenyl)methyl]-1,2,4-thiadiazol-5-amine. InChIKey: ZEZFQTOAJHHYCZ-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2S |
|---|---|
| Molecular weight | 251.31 g/mol |
| IUPAC name | N-[(2,4-dimethoxyphenyl)methyl]-1,2,4-thiadiazol-5-amine |
| InChIKey | ZEZFQTOAJHHYCZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CNC2=NC=NS2)OC |
Computed by PubChem (NCBI)