cas: 1063733-41-4 — see every product listed under this CAS number, including other names
N-(2,4-Dimethoxybenzyl)-1,2,4-thiadiazol-5-amine, 98% (CAS 1063733-41-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F244458-100MG |
| cas | 1063733-41-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 466.52 Pln | |
| Fluorochem | 5g | 1294.35 Pln | |
| Fluorochem | 10g | 2538.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-[(2,4-dimethoxyphenyl)methyl]-1,2,4-thiadiazol-5-amine (CAS 1063733-41-4) is a chemical compound with the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. IUPAC name: N-[(2,4-dimethoxyphenyl)methyl]-1,2,4-thiadiazol-5-amine. InChIKey: ZEZFQTOAJHHYCZ-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2S |
|---|---|
| Molecular weight | 251.31 g/mol |
| IUPAC name | N-[(2,4-dimethoxyphenyl)methyl]-1,2,4-thiadiazol-5-amine |
| InChIKey | ZEZFQTOAJHHYCZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CNC2=NC=NS2)OC |
Computed by PubChem (NCBI)