CAS 23673-10-1 is the registry number for 6,7-Dimethoxy-2-(methylthio)quinazolin-4-amine, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6,7-dimethoxy-2-methylsulfanylquinazolin-4-amine (CAS 23673-10-1) is a chemical compound with the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. IUPAC name: 6,7-dimethoxy-2-methylsulfanylquinazolin-4-amine. InChIKey: GXLPMEUYBFWKLS-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2S |
|---|---|
| Molecular weight | 251.31 g/mol |
| IUPAC name | 6,7-dimethoxy-2-methylsulfanylquinazolin-4-amine |
| InChIKey | GXLPMEUYBFWKLS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC(=N2)SC)N)OC |
Computed by PubChem (NCBI)