cas: 366-53-0 — see every product listed under this CAS number, including other names
N-(2,5-Difluoro-4-nitrophenyl)acetamide, 95%, 95% (CAS 366-53-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13E8QD-100mg |
| cas | 366-53-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 1g | 1086.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(2,5-difluoro-4-nitrophenyl)acetamide (CAS 366-53-0) is a chemical compound with the molecular formula C8H6F2N2O3 and a molecular weight of 216.14 g/mol. IUPAC name: N-(2,5-difluoro-4-nitrophenyl)acetamide. InChIKey: XSJFRSVXQJJKDY-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N2O3 |
|---|---|
| Molecular weight | 216.14 g/mol |
| IUPAC name | N-(2,5-difluoro-4-nitrophenyl)acetamide |
| InChIKey | XSJFRSVXQJJKDY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)