CAS 2092001-87-9 is the registry number for 2-(2,3-Difluoro-6-nitrophenyl)acetamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(2,3-difluoro-6-nitrophenyl)acetamide (CAS 2092001-87-9) is a chemical compound with the molecular formula C8H6F2N2O3 and a molecular weight of 216.14 g/mol. IUPAC name: 2-(2,3-difluoro-6-nitrophenyl)acetamide. InChIKey: JLFPNYIUBDKLJR-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N2O3 |
|---|---|
| Molecular weight | 216.14 g/mol |
| IUPAC name | 2-(2,3-difluoro-6-nitrophenyl)acetamide |
| InChIKey | JLFPNYIUBDKLJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])CC(=O)N)F)F |
Computed by PubChem (NCBI)