cas: 92-22-8 — see every product listed under this CAS number, including other names
N-(2,5-Diethoxyphenyl)benzamide, 98%(GC-MS),RG, 98%(GC-MS),RG (CAS 92-22-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IGZ8-100mg |
| cas | 92-22-8 |
| size | 100mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1293.20 Pln |
| purity | 98%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
N-(2,5-diethoxyphenyl)benzamide (CAS 92-22-8) is a chemical compound with the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. IUPAC name: N-(2,5-diethoxyphenyl)benzamide. InChIKey: OEZDYMAFWLGKFC-UHFFFAOYSA-N.
| Molecular formula | C17H19NO3 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | N-(2,5-diethoxyphenyl)benzamide |
| InChIKey | OEZDYMAFWLGKFC-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)OCC)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)