cas: 92-22-8 — see every product listed under this CAS number, including other names
n-(2,5-Diethoxyphenyl)benzamide (CAS 92-22-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F711393-1G |
| cas | 92-22-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 627.92 Pln | |
| Fluorochem | 5g | 2111.77 Pln |
| delivery time | 3-4 weeks |
|---|
N-(2,5-diethoxyphenyl)benzamide (CAS 92-22-8) is a chemical compound with the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. IUPAC name: N-(2,5-diethoxyphenyl)benzamide. InChIKey: OEZDYMAFWLGKFC-UHFFFAOYSA-N.
| Molecular formula | C17H19NO3 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | N-(2,5-diethoxyphenyl)benzamide |
| InChIKey | OEZDYMAFWLGKFC-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)OCC)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)