cas: 1150271-57-0 — see every product listed under this CAS number, including other names
N-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl)acetamide, 98% (CAS 1150271-57-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F213435-100MG |
| cas | 1150271-57-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1153.78 Pln | |
| Fluorochem | 5g | 3626.87 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]acetamide (CAS 1150271-57-0) is a chemical compound with the molecular formula C15H19BF3NO3 and a molecular weight of 329.12 g/mol. IUPAC name: N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]acetamide. InChIKey: IASCEYYAMDKIPA-UHFFFAOYSA-N.
| Molecular formula | C15H19BF3NO3 |
|---|---|
| Molecular weight | 329.12 g/mol |
| IUPAC name | N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)phenyl]acetamide |
| InChIKey | IASCEYYAMDKIPA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(F)(F)F)NC(=O)C |
Computed by PubChem (NCBI)