CAS 1150271-66-1 is the registry number for 4-Acetamido-3-(trifluoromethy)phenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]acetamide (CAS 1150271-66-1) is a chemical compound with the molecular formula C15H19BF3NO3 and a molecular weight of 329.12 g/mol. IUPAC name: N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]acetamide. InChIKey: LBTMJYMEGPLBQY-UHFFFAOYSA-N.
| Molecular formula | C15H19BF3NO3 |
|---|---|
| Molecular weight | 329.12 g/mol |
| IUPAC name | N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]acetamide |
| InChIKey | LBTMJYMEGPLBQY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NC(=O)C)C(F)(F)F |
Computed by PubChem (NCBI)