cas: 130775-30-3 — see every product listed under this CAS number, including other names
N-(2-(TERT-BUTYL)OXAZOL-4-YL)PIVALAMIDE, >95%, >95% (CAS 130775-30-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HS09-100mg |
| cas | 130775-30-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1509.20 Pln | |
| Chemat | 250mg | 2550.80 Pln | |
| Chemat | 1g | 6885.20 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
N-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-dimethylpropanamide (CAS 130775-30-3) is a chemical compound with the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. IUPAC name: N-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-dimethylpropanamide. InChIKey: FQTLDZBGFVPMMB-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O2 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | N-(2-tert-butyl-1,3-oxazol-4-yl)-2,2-dimethylpropanamide |
| InChIKey | FQTLDZBGFVPMMB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=CO1)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)