Products 93042-05-8
CAS 93042-05-8 is the registry number for 8-tert-Butyl-1,3-diazaspiro[4.5]decane-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione (CAS 93042-05-8) is a chemical compound with the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. IUPAC name: 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione. InChIKey: RQUKBTLNDXLLEA-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O2 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 8-tert-butyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| InChIKey | RQUKBTLNDXLLEA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2(CC1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)