cas: 171887-03-9 — see every product listed under this CAS number, including other names
N-(2-Amino-4,6-dichloropyrimidine-5-yl)formamide 98% HPLC (CAS 171887-03-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A237451-5g |
| cas | 171887-03-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 181.25 Pln | |
| Ambeed | 100g | 270.25 Pln | |
| Ambeed | 500g | 926.62 Pln | |
| Ambeed | 1000g | 1421.69 Pln |
| purity | 98% HPLC |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A237451 |
N-(2-amino-4,6-dichloropyrimidin-5-yl)formamide (CAS 171887-03-9) is a chemical compound with the molecular formula C5H4Cl2N4O and a molecular weight of 207.01 g/mol. IUPAC name: N-(2-amino-4,6-dichloropyrimidin-5-yl)formamide. InChIKey: XYWHZUCZNRMJGO-UHFFFAOYSA-N.
| Molecular formula | C5H4Cl2N4O |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | N-(2-amino-4,6-dichloropyrimidin-5-yl)formamide |
| InChIKey | XYWHZUCZNRMJGO-UHFFFAOYSA-N |
| SMILES | C(=O)NC1=C(N=C(N=C1Cl)N)Cl |
Computed by PubChem (NCBI)