cas: 171887-03-9 — see every product listed under this CAS number, including other names
N-(2-Amino-4,6-dichloropyrimidine-5-yl)formamide, 95%, 95% (CAS 171887-03-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148PE-5g |
| cas | 171887-03-9 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 100g | 174.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(2-amino-4,6-dichloropyrimidin-5-yl)formamide (CAS 171887-03-9) is a chemical compound with the molecular formula C5H4Cl2N4O and a molecular weight of 207.01 g/mol. IUPAC name: N-(2-amino-4,6-dichloropyrimidin-5-yl)formamide. InChIKey: XYWHZUCZNRMJGO-UHFFFAOYSA-N.
| Molecular formula | C5H4Cl2N4O |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | N-(2-amino-4,6-dichloropyrimidin-5-yl)formamide |
| InChIKey | XYWHZUCZNRMJGO-UHFFFAOYSA-N |
| SMILES | C(=O)NC1=C(N=C(N=C1Cl)N)Cl |
Computed by PubChem (NCBI)