cas: 84460-89-9 — see every product listed under this CAS number, including other names
N-(2-Aminoethyl)-1,2,3,4-tetrahydro-1-naphthalenecarboxamide, 95%, 95% (CAS 84460-89-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143TF-100mg |
| cas | 84460-89-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 875.60 Pln | |
| Chemat | 5g | 2454.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(2-aminoethyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide (CAS 84460-89-9) is a chemical compound with the molecular formula C13H18N2O and a molecular weight of 218.29 g/mol. IUPAC name: N-(2-aminoethyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide. InChIKey: ASNYEBSCXSIDAC-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | N-(2-aminoethyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
| InChIKey | ASNYEBSCXSIDAC-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2C1)C(=O)NCCN |
Computed by PubChem (NCBI)